About (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine
(3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine (PubChem CID 134405604) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine |
| PubChem CID | 134405604 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine |
| SMILES | C=C(NC)/C(C)=C/CCF |
| InChI | InChI=1S/C8H14FN/c1-7(5-4-6-9)8(2)10-3/h5,10H,2,4,6H2,1,3H3/b7-5+ |
| InChIKey | ZHYDHVGYFAEJQT-FNORWQNLSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine?
The IUPAC name of (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine (CID 134405604) is (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine.
What is the SMILES notation for (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine?
The canonical SMILES for (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine is C=C(NC)/C(C)=C/CCF.
What is the InChIKey of (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine?
The InChIKey is ZHYDHVGYFAEJQT-FNORWQNLSA-N. The full InChI is InChI=1S/C8H14FN/c1-7(5-4-6-9)8(2)10-3/h5,10H,2,4,6H2,1,3H3/b7-5+.
What are the key properties of (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine?
(3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine has a molecular weight of 143.20 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-fluoro-N,3-dimethylhexa-1,3-dien-2-amine is sourced from PubChem (CID 134405604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).