C19H27FN2O2 — CID 134405787
3-[4-[(cyclopropylamino)methyl]-4-[(3-fluorophenyl)methyl]piperidin-1-yl]propanoic acid (PubChem CID 134405787) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-[4-[(cyclopropylamino)methyl]-4-[(3-fluorophenyl)methyl]piperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-[(cyclopropylamino)methyl]-4-[(3-fluorophenyl)methyl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 134405787 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-[4-[(cyclopropylamino)methyl]-4-[(3-fluorophenyl)methyl]piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC(CNC2CC2)(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H27FN2O2/c20-16-3-1-2-15(12-16)13-19(14-21-17-4-5-17)7-10-22(11-8-19)9-6-18(23)24/h1-3,12,17,21H,4-11,13-14H2,(H,23,24) |
| InChIKey | HJCWTRNLETWCIU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |