C14H21NO — CID 134405966
(3E,5E)-6-(6-methyl-1,2-dihydropyridin-3-yl)octa-3,5-dien-3-ol (PubChem CID 134405966) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3E,5E)-6-(6-methyl-1,2-dihydropyridin-3-yl)octa-3,5-dien-3-ol.
| Compound Name | (3E,5E)-6-(6-methyl-1,2-dihydropyridin-3-yl)octa-3,5-dien-3-ol |
|---|---|
| PubChem CID | 134405966 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3E,5E)-6-(6-methyl-1,2-dihydropyridin-3-yl)octa-3,5-dien-3-ol |
| SMILES | CC/C(O)=C\C=C(/CC)C1=CC=C(C)NC1 |
| InChI | InChI=1S/C14H21NO/c1-4-12(8-9-14(16)5-2)13-7-6-11(3)15-10-13/h6-9,15-16H,4-5,10H2,1-3H3/b12-8+,14-9+ |
| InChIKey | OUIDIMWHMSEZHV-MXOVAJDFSA-N |
| XLogP | 3.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|