About 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine
6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine (PubChem CID 134405972) has the molecular formula C9H13FN4O
and a molecular weight of 212.23 g/mol. Its IUPAC name is 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine.
Molecular Properties
| Compound Name | 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine |
| PubChem CID | 134405972 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine |
| SMILES | CNc1ccc(O[C@H]2CNC[C@@H]2F)nn1 |
| InChI | InChI=1S/C9H13FN4O/c1-11-8-2-3-9(14-13-8)15-7-5-12-4-6(7)10/h2-3,6-7,12H,4-5H2,1H3,(H,11,13)/t6-,7-/m0/s1 |
| InChIKey | GAPSOJOOFNWRJG-BQBZGAKWSA-N |
| XLogP | 0.21 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine?
The IUPAC name of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine (CID 134405972) is 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine.
What is the SMILES notation for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine?
The canonical SMILES for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine is CNc1ccc(O[C@H]2CNC[C@@H]2F)nn1.
What is the InChIKey of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine?
The InChIKey is GAPSOJOOFNWRJG-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H13FN4O/c1-11-8-2-3-9(14-13-8)15-7-5-12-4-6(7)10/h2-3,6-7,12H,4-5H2,1H3,(H,11,13)/t6-,7-/m0/s1.
What are the key properties of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine?
6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine has a molecular weight of 212.23 g/mol, XLogP of 0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxy-N-methylpyridazin-3-amine is sourced from PubChem (CID 134405972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).