About (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine
(2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine (PubChem CID 134406064) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine.
Molecular Properties
| Compound Name | (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine |
| PubChem CID | 134406064 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine |
| SMILES | C/C=C/C/C=C(\C=NC)/N1CCNCC1 |
| InChI | InChI=1S/C12H21N3/c1-3-4-5-6-12(11-13-2)15-9-7-14-8-10-15/h3-4,6,11,14H,5,7-10H2,1-2H3/b4-3+,12-6+,13-11? |
| InChIKey | JBFOUKLIHSJWLS-FAINNWKPSA-N |
| XLogP | 1.30 |
| TPSA | 27.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 248 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine?
The IUPAC name of (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine (CID 134406064) is (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine.
What is the SMILES notation for (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine?
The canonical SMILES for (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine is C/C=C/C/C=C(\C=NC)/N1CCNCC1.
What is the InChIKey of (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine?
The InChIKey is JBFOUKLIHSJWLS-FAINNWKPSA-N. The full InChI is InChI=1S/C12H21N3/c1-3-4-5-6-12(11-13-2)15-9-7-14-8-10-15/h3-4,6,11,14H,5,7-10H2,1-2H3/b4-3+,12-6+,13-11?.
What are the key properties of (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine?
(2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine has a molecular weight of 207.32 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5E)-N-methyl-2-piperazin-1-ylhepta-2,5-dien-1-imine is sourced from PubChem (CID 134406064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).