C12H22N2O — CID 134406106
N-[(4E,7Z)-4-methyl-8-(methylamino)nona-4,7-dienyl]formamide (PubChem CID 134406106) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(4E,7Z)-4-methyl-8-(methylamino)nona-4,7-dienyl]formamide.
| Compound Name | N-[(4E,7Z)-4-methyl-8-(methylamino)nona-4,7-dienyl]formamide |
|---|---|
| PubChem CID | 134406106 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(4E,7Z)-4-methyl-8-(methylamino)nona-4,7-dienyl]formamide |
| SMILES | CN/C(C)=C\C/C=C(\C)CCCNC=O |
| InChI | InChI=1S/C12H22N2O/c1-11(7-5-9-14-10-15)6-4-8-12(2)13-3/h6,8,10,13H,4-5,7,9H2,1-3H3,(H,14,15)/b11-6+,12-8- |
| InChIKey | WZNKPBUUQKJMBM-SZJFEJKCSA-N |
| XLogP | 1.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|