C11H24N4 — CID 134406107
(1E,3Z)-1-N'-ethyl-1-N'-[2-(ethylamino)ethyl]penta-1,3-diene-1,1,4-triamine (PubChem CID 134406107) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is (1E,3Z)-1-N'-ethyl-1-N'-[2-(ethylamino)ethyl]penta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-ethyl-1-N'-[2-(ethylamino)ethyl]penta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406107 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | (1E,3Z)-1-N'-ethyl-1-N'-[2-(ethylamino)ethyl]penta-1,3-diene-1,1,4-triamine |
| SMILES | CCNCCN(CC)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C11H24N4/c1-4-14-8-9-15(5-2)11(13)7-6-10(3)12/h6-7,14H,4-5,8-9,12-13H2,1-3H3/b10-6-,11-7+ |
| InChIKey | NQPCHVGRTBIBNT-NAKBGQTNSA-N |
| XLogP | 0.58 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|