About (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid
(3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid (PubChem CID 134406130) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid.
Molecular Properties
| Compound Name | (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid |
| PubChem CID | 134406130 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid |
| SMILES | C/C(N)=C/C=C(\C)CC(=O)O |
| InChI | InChI=1S/C8H13NO2/c1-6(5-8(10)11)3-4-7(2)9/h3-4H,5,9H2,1-2H3,(H,10,11)/b6-3+,7-4- |
| InChIKey | HLINLBPTQQHBTQ-JOVCIAKGSA-N |
| XLogP | 1.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid?
The IUPAC name of (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid (CID 134406130) is (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid.
What is the SMILES notation for (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid?
The canonical SMILES for (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid is C/C(N)=C/C=C(\C)CC(=O)O.
What is the InChIKey of (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid?
The InChIKey is HLINLBPTQQHBTQ-JOVCIAKGSA-N. The full InChI is InChI=1S/C8H13NO2/c1-6(5-8(10)11)3-4-7(2)9/h3-4H,5,9H2,1-2H3,(H,10,11)/b6-3+,7-4-.
What are the key properties of (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid?
(3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid has a molecular weight of 155.20 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-6-amino-3-methylhepta-3,5-dienoic acid is sourced from PubChem (CID 134406130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).