About 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one
4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one (PubChem CID 134406135) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one.
Molecular Properties
| Compound Name | 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one |
| PubChem CID | 134406135 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one |
| SMILES | CC/C(=C\C/C=C(/C)NC)CN1CCOCC1=O |
| InChI | InChI=1S/C14H24N2O2/c1-4-13(7-5-6-12(2)15-3)10-16-8-9-18-11-14(16)17/h6-7,15H,4-5,8-11H2,1-3H3/b12-6-,13-7+ |
| InChIKey | YZXYIVLZCGEHEE-VOFKWTQNSA-N |
| XLogP | 1.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one?
The IUPAC name of 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one (CID 134406135) is 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one.
What is the SMILES notation for 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one?
The canonical SMILES for 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one is CC/C(=C\C/C=C(/C)NC)CN1CCOCC1=O.
What is the InChIKey of 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one?
The InChIKey is YZXYIVLZCGEHEE-VOFKWTQNSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-4-13(7-5-6-12(2)15-3)10-16-8-9-18-11-14(16)17/h6-7,15H,4-5,8-11H2,1-3H3/b12-6-,13-7+.
What are the key properties of 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one?
4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one has a molecular weight of 252.36 g/mol, XLogP of 1.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,5Z)-2-ethyl-6-(methylamino)hepta-2,5-dienyl]morpholin-3-one is sourced from PubChem (CID 134406135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).