C10H22N4 — CID 134406146
(1E,3Z)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylpenta-1,3-diene-1,1,4-triamine (PubChem CID 134406146) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylpenta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406146 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | (1E,3Z)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
| SMILES | CCNCCN(C)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C10H22N4/c1-4-13-7-8-14(3)10(12)6-5-9(2)11/h5-6,13H,4,7-8,11-12H2,1-3H3/b9-5-,10-6+ |
| InChIKey | YEAQGDACXYSFHE-VTBWALSUSA-N |
| XLogP | 0.19 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|