C10H19N3 — CID 134406164
(1Z,3Z)-1-piperidin-4-ylpenta-1,3-diene-1,4-diamine (PubChem CID 134406164) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1Z,3Z)-1-piperidin-4-ylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-piperidin-4-ylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406164 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1Z,3Z)-1-piperidin-4-ylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)C1CCNCC1 |
| InChI | InChI=1S/C10H19N3/c1-8(11)2-3-10(12)9-4-6-13-7-5-9/h2-3,9,13H,4-7,11-12H2,1H3/b8-2-,10-3- |
| InChIKey | ANSOSKUFHLREJS-DJHVICIBSA-N |
| XLogP | 0.69 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|