C10H19N3O — CID 134406174
1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-4-ol (PubChem CID 134406174) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-4-ol.
| Compound Name | 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 134406174 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-4-ol |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(O)CC1 |
| InChI | InChI=1S/C10H19N3O/c1-8(11)2-3-10(12)13-6-4-9(14)5-7-13/h2-3,9,14H,4-7,11-12H2,1H3/b8-2-,10-3+ |
| InChIKey | DNJPYEKMAKKLDQ-AVBCCAMWSA-N |
| XLogP | 0.11 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|