C12H23N3O — CID 134406181
1-[(2E,4Z)-2-methyl-5-(methylamino)hexa-2,4-dienyl]-3-propylurea (PubChem CID 134406181) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-methyl-5-(methylamino)hexa-2,4-dienyl]-3-propylurea.
| Compound Name | 1-[(2E,4Z)-2-methyl-5-(methylamino)hexa-2,4-dienyl]-3-propylurea |
|---|---|
| PubChem CID | 134406181 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[(2E,4Z)-2-methyl-5-(methylamino)hexa-2,4-dienyl]-3-propylurea |
| SMILES | CCCNC(=O)NC/C(C)=C/C=C(/C)NC |
| InChI | InChI=1S/C12H23N3O/c1-5-8-14-12(16)15-9-10(2)6-7-11(3)13-4/h6-7,13H,5,8-9H2,1-4H3,(H2,14,15,16)/b10-6+,11-7- |
| InChIKey | UBUWFQVTLXTQNG-QZTBCQRESA-N |
| XLogP | 1.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|