C13H27N3 — CID 134406193
(2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N,5-N,2-trimethylhexa-2,4-diene-1,5-diamine (PubChem CID 134406193) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N,5-N,2-trimethylhexa-2,4-diene-1,5-diamine.
| Compound Name | (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N,5-N,2-trimethylhexa-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 134406193 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N,5-N,2-trimethylhexa-2,4-diene-1,5-diamine |
| SMILES | CCNCCN(C)C/C(C)=C/C=C(/C)NC |
| InChI | InChI=1S/C13H27N3/c1-6-15-9-10-16(5)11-12(2)7-8-13(3)14-4/h7-8,14-15H,6,9-11H2,1-5H3/b12-7+,13-8- |
| InChIKey | FVHDOQOYSVWPHC-GUFPOKFQSA-N |
| XLogP | 1.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|