C13H26N2O — CID 134406202
(2Z,4E)-5-N-(2-methoxyethyl)-2-N,5-N-dimethylocta-2,4-diene-2,5-diamine (PubChem CID 134406202) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (2Z,4E)-5-N-(2-methoxyethyl)-2-N,5-N-dimethylocta-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4E)-5-N-(2-methoxyethyl)-2-N,5-N-dimethylocta-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 134406202 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (2Z,4E)-5-N-(2-methoxyethyl)-2-N,5-N-dimethylocta-2,4-diene-2,5-diamine |
| SMILES | CCC/C(=C\C=C(\C)NC)N(C)CCOC |
| InChI | InChI=1S/C13H26N2O/c1-6-7-13(9-8-12(2)14-3)15(4)10-11-16-5/h8-9,14H,6-7,10-11H2,1-5H3/b12-8-,13-9+ |
| InChIKey | SBQVIEMVNZXTIM-QRBCZBMESA-N |
| XLogP | 2.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|