C12H21N3O — CID 134406206
2-(ethylamino)-N-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]acetamide (PubChem CID 134406206) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(ethylamino)-N-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]acetamide.
| Compound Name | 2-(ethylamino)-N-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 134406206 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(ethylamino)-N-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]acetamide |
| SMILES | C=N/C(C)=C\C=C(/C)CNC(=O)CNCC |
| InChI | InChI=1S/C12H21N3O/c1-5-14-9-12(16)15-8-10(2)6-7-11(3)13-4/h6-7,14H,4-5,8-9H2,1-3H3,(H,15,16)/b10-6+,11-7- |
| InChIKey | CCUYCLKQLXXUQH-QZTBCQRESA-N |
| XLogP | 1.26 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|