C11H23N3 — CID 134406221
(2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N-methylhexa-2,4-diene-1,5-diamine (PubChem CID 134406221) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N-methylhexa-2,4-diene-1,5-diamine.
| Compound Name | (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N-methylhexa-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 134406221 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (2E,4Z)-1-N-[2-(ethylamino)ethyl]-1-N-methylhexa-2,4-diene-1,5-diamine |
| SMILES | CCNCCN(C)C/C=C/C=C(/C)N |
| InChI | InChI=1S/C11H23N3/c1-4-13-8-10-14(3)9-6-5-7-11(2)12/h5-7,13H,4,8-10,12H2,1-3H3/b6-5+,11-7- |
| InChIKey | QWSZFSYLMZDZMA-VLHCFCLRSA-N |
| XLogP | 0.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|