C12H23N3 — CID 134406263
N-ethyl-N'-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]ethane-1,2-diamine (PubChem CID 134406263) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-ethyl-N'-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134406263 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-ethyl-N'-[(2E,4Z)-2-methyl-5-(methylideneamino)hexa-2,4-dienyl]ethane-1,2-diamine |
| SMILES | C=N/C(C)=C\C=C(/C)CNCCNCC |
| InChI | InChI=1S/C12H23N3/c1-5-14-8-9-15-10-11(2)6-7-12(3)13-4/h6-7,14-15H,4-5,8-10H2,1-3H3/b11-6+,12-7- |
| InChIKey | OELJLPVBXJXLGE-CZIBKUHYSA-N |
| XLogP | 1.74 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|