About (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine
(E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine (PubChem CID 134406270) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine |
| PubChem CID | 134406270 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine |
| SMILES | CC/C=C(\N)N(C)CCNCC |
| InChI | InChI=1S/C9H21N3/c1-4-6-9(10)12(3)8-7-11-5-2/h6,11H,4-5,7-8,10H2,1-3H3/b9-6+ |
| InChIKey | UWXPOHBRMFQJGI-RMKNXTFCSA-N |
| XLogP | 0.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine?
The IUPAC name of (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine (CID 134406270) is (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine.
What is the SMILES notation for (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine?
The canonical SMILES for (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine is CC/C=C(\N)N(C)CCNCC.
What is the InChIKey of (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine?
The InChIKey is UWXPOHBRMFQJGI-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H21N3/c1-4-6-9(10)12(3)8-7-11-5-2/h6,11H,4-5,7-8,10H2,1-3H3/b9-6+.
What are the key properties of (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine?
(E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine has a molecular weight of 171.29 g/mol, XLogP of 0.74, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N'-[2-(ethylamino)ethyl]-1-N'-methylbut-1-ene-1,1-diamine is sourced from PubChem (CID 134406270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).