About 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol
1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol (PubChem CID 134406296) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol |
| PubChem CID | 134406296 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol |
| SMILES | C/C(N)=C/C=CC(N)N1CCC(O)C1 |
| InChI | InChI=1S/C10H19N3O/c1-8(11)3-2-4-10(12)13-6-5-9(14)7-13/h2-4,9-10,14H,5-7,11-12H2,1H3/b4-2?,8-3- |
| InChIKey | LEVBTVQWUSAZNN-ZGVMDFCPSA-N |
| XLogP | -0.24 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol?
The IUPAC name of 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol (CID 134406296) is 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol is C/C(N)=C/C=CC(N)N1CCC(O)C1.
What is the InChIKey of 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol?
The InChIKey is LEVBTVQWUSAZNN-ZGVMDFCPSA-N. The full InChI is InChI=1S/C10H19N3O/c1-8(11)3-2-4-10(12)13-6-5-9(14)7-13/h2-4,9-10,14H,5-7,11-12H2,1H3/b4-2?,8-3-.
What are the key properties of 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol?
1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol has a molecular weight of 197.28 g/mol, XLogP of -0.24, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-1,5-diaminohexa-2,4-dienyl]pyrrolidin-3-ol is sourced from PubChem (CID 134406296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).