About N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide
N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide (PubChem CID 134406297) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide.
Molecular Properties
| Compound Name | N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide |
| PubChem CID | 134406297 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide |
| SMILES | CC1=CC=C(N(C)C=O)CN1C |
| InChI | InChI=1S/C9H14N2O/c1-8-4-5-9(6-10(8)2)11(3)7-12/h4-5,7H,6H2,1-3H3 |
| InChIKey | YJKFQYWRHMCFQA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide?
The IUPAC name of N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide (CID 134406297) is N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide.
What is the SMILES notation for N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide?
The canonical SMILES for N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide is CC1=CC=C(N(C)C=O)CN1C.
What is the InChIKey of N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide?
The InChIKey is YJKFQYWRHMCFQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-8-4-5-9(6-10(8)2)11(3)7-12/h4-5,7H,6H2,1-3H3.
What are the key properties of N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide?
N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide has a molecular weight of 166.22 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,6-dimethyl-2H-pyridin-3-yl)-N-methylformamide is sourced from PubChem (CID 134406297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).