C12H25N3 — CID 134406306
(2E,4Z)-2-ethyl-1-N-[2-(ethylamino)ethyl]hexa-2,4-diene-1,5-diamine (PubChem CID 134406306) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is (2E,4Z)-2-ethyl-1-N-[2-(ethylamino)ethyl]hexa-2,4-diene-1,5-diamine.
| Compound Name | (2E,4Z)-2-ethyl-1-N-[2-(ethylamino)ethyl]hexa-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 134406306 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (2E,4Z)-2-ethyl-1-N-[2-(ethylamino)ethyl]hexa-2,4-diene-1,5-diamine |
| SMILES | CCNCCNC/C(=C/C=C(/C)N)CC |
| InChI | InChI=1S/C12H25N3/c1-4-12(7-6-11(3)13)10-15-9-8-14-5-2/h6-7,14-15H,4-5,8-10,13H2,1-3H3/b11-6-,12-7+ |
| InChIKey | UKIKFKKCAGHPJV-TWTKIJFOSA-N |
| XLogP | 1.38 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|