C8H17N3O — CID 134406326
(1E,3Z)-1-[2-(methylamino)ethoxy]penta-1,3-diene-1,4-diamine (PubChem CID 134406326) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is (1E,3Z)-1-[2-(methylamino)ethoxy]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[2-(methylamino)ethoxy]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406326 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (1E,3Z)-1-[2-(methylamino)ethoxy]penta-1,3-diene-1,4-diamine |
| SMILES | CNCCO/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C8H17N3O/c1-7(9)3-4-8(10)12-6-5-11-2/h3-4,11H,5-6,9-10H2,1-2H3/b7-3-,8-4+ |
| InChIKey | WBTFHRFDBPAMNG-KYPMKJFLSA-N |
| XLogP | -0.12 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|