About (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine
(E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 134406368) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine |
| PubChem CID | 134406368 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C=C(C)/N=C/C(=C\C)N1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C14H23N3/c1-4-13(9-16-12(2)3)17-10-14(11-17)5-7-15-8-6-14/h4,9,15H,2,5-8,10-11H2,1,3H3/b13-4+,16-9+ |
| InChIKey | OJSWAKLYEHQVCA-WUVOGLOJSA-N |
| XLogP | 2.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine?
The IUPAC name of (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine (CID 134406368) is (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine.
What is the SMILES notation for (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine?
The canonical SMILES for (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine is C=C(C)/N=C/C(=C\C)N1CC2(CCNCC2)C1.
What is the InChIKey of (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine?
The InChIKey is OJSWAKLYEHQVCA-WUVOGLOJSA-N. The full InChI is InChI=1S/C14H23N3/c1-4-13(9-16-12(2)3)17-10-14(11-17)5-7-15-8-6-14/h4,9,15H,2,5-8,10-11H2,1,3H3/b13-4+,16-9+.
What are the key properties of (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine?
(E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine has a molecular weight of 233.36 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2,7-diazaspiro[3.5]nonan-2-yl)-N-prop-1-en-2-ylbut-2-en-1-imine is sourced from PubChem (CID 134406368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).