C12H23N3 — CID 134406369
1-[3-[[(Z)-but-2-en-2-yl]amino]prop-1-en-2-yl]piperidin-4-amine (PubChem CID 134406369) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-[3-[[(Z)-but-2-en-2-yl]amino]prop-1-en-2-yl]piperidin-4-amine.
| Compound Name | 1-[3-[[(Z)-but-2-en-2-yl]amino]prop-1-en-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 134406369 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-[3-[[(Z)-but-2-en-2-yl]amino]prop-1-en-2-yl]piperidin-4-amine |
| SMILES | C=C(CN/C(C)=C\C)N1CCC(N)CC1 |
| InChI | InChI=1S/C12H23N3/c1-4-10(2)14-9-11(3)15-7-5-12(13)6-8-15/h4,12,14H,3,5-9,13H2,1-2H3/b10-4- |
| InChIKey | ZDLREXFPXXWRNY-WMZJFQQLSA-N |
| XLogP | 1.44 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |