About (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine
(2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine (PubChem CID 134406413) has the molecular formula C11H21FN2O
and a molecular weight of 216.30 g/mol. Its IUPAC name is (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine |
| PubChem CID | 134406413 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine |
| SMILES | CNCC(F)CO/C(C)=C/C=C(/C)NC |
| InChI | InChI=1S/C11H21FN2O/c1-9(14-4)5-6-10(2)15-8-11(12)7-13-3/h5-6,11,13-14H,7-8H2,1-4H3/b9-5-,10-6+ |
| InChIKey | CBHMUJLDURXKOD-VTBWALSUSA-N |
| XLogP | 1.59 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine?
The IUPAC name of (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine (CID 134406413) is (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine?
The canonical SMILES for (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine is CNCC(F)CO/C(C)=C/C=C(/C)NC.
What is the InChIKey of (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine?
The InChIKey is CBHMUJLDURXKOD-VTBWALSUSA-N. The full InChI is InChI=1S/C11H21FN2O/c1-9(14-4)5-6-10(2)15-8-11(12)7-13-3/h5-6,11,13-14H,7-8H2,1-4H3/b9-5-,10-6+.
What are the key properties of (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine?
(2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine has a molecular weight of 216.30 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-[2-fluoro-3-(methylamino)propoxy]-N-methylhexa-2,4-dien-2-amine is sourced from PubChem (CID 134406413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).