C11H21N3O — CID 134406426
N-[(1E,4Z)-5-aminohexa-1,4-dienyl]-N-[2-(ethylamino)ethyl]formamide (PubChem CID 134406426) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-[(1E,4Z)-5-aminohexa-1,4-dienyl]-N-[2-(ethylamino)ethyl]formamide.
| Compound Name | N-[(1E,4Z)-5-aminohexa-1,4-dienyl]-N-[2-(ethylamino)ethyl]formamide |
|---|---|
| PubChem CID | 134406426 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-[(1E,4Z)-5-aminohexa-1,4-dienyl]-N-[2-(ethylamino)ethyl]formamide |
| SMILES | CCNCCN(C=O)/C=C/C/C=C(/C)N |
| InChI | InChI=1S/C11H21N3O/c1-3-13-7-9-14(10-15)8-5-4-6-11(2)12/h5-6,8,10,13H,3-4,7,9,12H2,1-2H3/b8-5+,11-6- |
| InChIKey | HFTRZNOBDXUSMY-CZDIAPPSSA-N |
| XLogP | 0.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|