C10H18N4O — CID 134406430
(1E,3Z)-1-(4-nitrosopiperidin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 134406430) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is (1E,3Z)-1-(4-nitrosopiperidin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(4-nitrosopiperidin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406430 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (1E,3Z)-1-(4-nitrosopiperidin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(N=O)CC1 |
| InChI | InChI=1S/C10H18N4O/c1-8(11)2-3-10(12)14-6-4-9(13-15)5-7-14/h2-3,9H,4-7,11-12H2,1H3/b8-2-,10-3+ |
| InChIKey | XFZCBDSLCUXTJQ-AVBCCAMWSA-N |
| XLogP | 0.88 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|