C11H22N4 — CID 134406435
(1E,3Z)-1-(4-amino-4-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 134406435) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1E,3Z)-1-(4-amino-4-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(4-amino-4-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406435 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | (1E,3Z)-1-(4-amino-4-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(C)(N)CC1 |
| InChI | InChI=1S/C11H22N4/c1-9(12)3-4-10(13)15-7-5-11(2,14)6-8-15/h3-4H,5-8,12-14H2,1-2H3/b9-3-,10-4+ |
| InChIKey | IWEJIBLWWOZLJJ-INWPEIIHSA-N |
| XLogP | 0.46 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|