C10H21N3O — CID 134406438
(1E,3Z)-1-[1-(methylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine (PubChem CID 134406438) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is (1E,3Z)-1-[1-(methylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[1-(methylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406438 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (1E,3Z)-1-[1-(methylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine |
| SMILES | CCC(CNC)O/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C10H21N3O/c1-4-9(7-13-3)14-10(12)6-5-8(2)11/h5-6,9,13H,4,7,11-12H2,1-3H3/b8-5-,10-6+ |
| InChIKey | MQMXQJIFJVLNMN-YBMVAOSUSA-N |
| XLogP | 0.66 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|