C11H23N3O — CID 134406440
(1E,3Z)-1-[4-(ethylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine (PubChem CID 134406440) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is (1E,3Z)-1-[4-(ethylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[4-(ethylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406440 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | (1E,3Z)-1-[4-(ethylamino)butan-2-yloxy]penta-1,3-diene-1,4-diamine |
| SMILES | CCNCCC(C)O/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C11H23N3O/c1-4-14-8-7-10(3)15-11(13)6-5-9(2)12/h5-6,10,14H,4,7-8,12-13H2,1-3H3/b9-5-,11-6+ |
| InChIKey | FWQGFXQYMMHANS-YCQMDOFOSA-N |
| XLogP | 1.05 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|