C11H23N3 — CID 134406443
(2Z,4E)-2-N,5-N-dimethyl-5-N-[2-(methylamino)ethyl]hexa-2,4-diene-2,5-diamine (PubChem CID 134406443) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (2Z,4E)-2-N,5-N-dimethyl-5-N-[2-(methylamino)ethyl]hexa-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4E)-2-N,5-N-dimethyl-5-N-[2-(methylamino)ethyl]hexa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 134406443 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (2Z,4E)-2-N,5-N-dimethyl-5-N-[2-(methylamino)ethyl]hexa-2,4-diene-2,5-diamine |
| SMILES | CNCCN(C)/C(C)=C/C=C(/C)NC |
| InChI | InChI=1S/C11H23N3/c1-10(13-4)6-7-11(2)14(5)9-8-12-3/h6-7,12-13H,8-9H2,1-5H3/b10-6-,11-7+ |
| InChIKey | ITPKDMOZDFICPX-NAKBGQTNSA-N |
| XLogP | 1.16 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|