C14H28N4 — CID 134406444
(1E,3Z)-1-(4-pentylpiperazin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 134406444) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is (1E,3Z)-1-(4-pentylpiperazin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(4-pentylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406444 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (1E,3Z)-1-(4-pentylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | CCCCCN1CCN(/C(N)=C/C=C(/C)N)CC1 |
| InChI | InChI=1S/C14H28N4/c1-3-4-5-8-17-9-11-18(12-10-17)14(16)7-6-13(2)15/h6-7H,3-5,8-12,15-16H2,1-2H3/b13-6-,14-7+ |
| InChIKey | OXLIKNQEZAYOJH-SBLPDQQFSA-N |
| XLogP | 1.46 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|