C11H23N3 — CID 134406447
(1E,3Z)-1-N'-ethyl-1-N'-(3-methylbutyl)buta-1,3-diene-1,1,4-triamine (PubChem CID 134406447) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (1E,3Z)-1-N'-ethyl-1-N'-(3-methylbutyl)buta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-ethyl-1-N'-(3-methylbutyl)buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406447 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (1E,3Z)-1-N'-ethyl-1-N'-(3-methylbutyl)buta-1,3-diene-1,1,4-triamine |
| SMILES | CCN(CCC(C)C)/C(N)=C/C=C\N |
| InChI | InChI=1S/C11H23N3/c1-4-14(9-7-10(2)3)11(13)6-5-8-12/h5-6,8,10H,4,7,9,12-13H2,1-3H3/b8-5-,11-6+ |
| InChIKey | LOKRQVWTNMWAFE-CWQCMXISSA-N |
| XLogP | 1.63 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|