About 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide
3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide (PubChem CID 13440646) has the molecular formula C16H17ClN2O
and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide.
Molecular Properties
| Compound Name | 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide |
| PubChem CID | 13440646 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1cccc(Cl)c1)c1cc(C)cc(C)n1 |
| InChI | InChI=1S/C16H17ClN2O/c1-4-19(15-9-11(2)8-12(3)18-15)16(20)13-6-5-7-14(17)10-13/h5-10H,4H2,1-3H3 |
| InChIKey | YFWRHZHVIRZOPJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide?
The IUPAC name of 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide (CID 13440646) is 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide.
What is the SMILES notation for 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide?
The canonical SMILES for 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide is CCN(C(=O)c1cccc(Cl)c1)c1cc(C)cc(C)n1.
What is the InChIKey of 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide?
The InChIKey is YFWRHZHVIRZOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O/c1-4-19(15-9-11(2)8-12(3)18-15)16(20)13-6-5-7-14(17)10-13/h5-10H,4H2,1-3H3.
What are the key properties of 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide?
3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide has a molecular weight of 288.78 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(4,6-dimethyl-2-pyridinyl)-N-ethylbenzamide is sourced from PubChem (CID 13440646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).