C11H16FIN2O — CID 134406460
(1E,3E)-4-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-1-iodohexa-1,3,5-trien-1-amine (PubChem CID 134406460) has the molecular formula C11H16FIN2O and a molecular weight of 338.16 g/mol. Its IUPAC name is (1E,3E)-4-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-1-iodohexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-4-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-1-iodohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 134406460 |
| Molecular Formula | C11H16FIN2O |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (1E,3E)-4-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-1-iodohexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C=C(/N)I)O[C@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C11H16FIN2O/c1-2-8(3-4-11(13)14)16-10-5-6-15-7-9(10)12/h2-4,9-10,15H,1,5-7,14H2/b8-3+,11-4-/t9-,10+/m1/s1 |
| InChIKey | HDXISQPTHWUIIQ-QCBQFRTGSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|