About N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide
N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide (PubChem CID 134406541) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide.
Molecular Properties
| Compound Name | N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide |
| PubChem CID | 134406541 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)/C(C)=C/C=C(/C)N |
| InChI | InChI=1S/C10H18N2O/c1-5-12(10(4)13)9(3)7-6-8(2)11/h6-7H,5,11H2,1-4H3/b8-6-,9-7+ |
| InChIKey | UGKHFGAUUVLFTO-MKKAVFGOSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide?
The IUPAC name of N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide (CID 134406541) is N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide.
What is the SMILES notation for N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide?
The canonical SMILES for N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide is CCN(C(C)=O)/C(C)=C/C=C(/C)N.
What is the InChIKey of N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide?
The InChIKey is UGKHFGAUUVLFTO-MKKAVFGOSA-N. The full InChI is InChI=1S/C10H18N2O/c1-5-12(10(4)13)9(3)7-6-8(2)11/h6-7H,5,11H2,1-4H3/b8-6-,9-7+.
What are the key properties of N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide?
N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide has a molecular weight of 182.27 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-N-ethylacetamide is sourced from PubChem (CID 134406541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).