About N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide
N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide (PubChem CID 134406573) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide |
| PubChem CID | 134406573 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCN(/C=C/C=C(/C)N)C(C)=O |
| InChI | InChI=1S/C10H19N3O/c1-9(11)5-4-7-13(10(2)14)8-6-12-3/h4-5,7,12H,6,8,11H2,1-3H3/b7-4+,9-5- |
| InChIKey | VFPJEJGRUVCMKD-HQHVODAESA-N |
| XLogP | 0.43 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide?
The IUPAC name of N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide (CID 134406573) is N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide.
What is the SMILES notation for N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide?
The canonical SMILES for N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide is CNCCN(/C=C/C=C(/C)N)C(C)=O.
What is the InChIKey of N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide?
The InChIKey is VFPJEJGRUVCMKD-HQHVODAESA-N. The full InChI is InChI=1S/C10H19N3O/c1-9(11)5-4-7-13(10(2)14)8-6-12-3/h4-5,7,12H,6,8,11H2,1-3H3/b7-4+,9-5-.
What are the key properties of N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide?
N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide has a molecular weight of 197.28 g/mol, XLogP of 0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3Z)-4-aminopenta-1,3-dienyl]-N-[2-(methylamino)ethyl]acetamide is sourced from PubChem (CID 134406573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).