About (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine
(1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine (PubChem CID 134406582) has the molecular formula C9H15IN4
and a molecular weight of 306.15 g/mol. Its IUPAC name is (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine |
| PubChem CID | 134406582 |
| Molecular Formula | C9H15IN4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine |
| SMILES | C=N/C(I)=C\C=C(/N)N1CCNCC1 |
| InChI | InChI=1S/C9H15IN4/c1-12-8(10)2-3-9(11)14-6-4-13-5-7-14/h2-3,13H,1,4-7,11H2/b8-2-,9-3+ |
| InChIKey | IUYYREYISGROTC-GPBXNHIQSA-N |
| XLogP | 0.67 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine?
The IUPAC name of (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine (CID 134406582) is (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine?
The canonical SMILES for (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine is C=N/C(I)=C\C=C(/N)N1CCNCC1.
What is the InChIKey of (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine?
The InChIKey is IUYYREYISGROTC-GPBXNHIQSA-N. The full InChI is InChI=1S/C9H15IN4/c1-12-8(10)2-3-9(11)14-6-4-13-5-7-14/h2-3,13H,1,4-7,11H2/b8-2-,9-3+.
What are the key properties of (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine?
(1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine has a molecular weight of 306.15 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-4-iodo-4-(methylideneamino)-1-piperazin-1-ylbuta-1,3-dien-1-amine is sourced from PubChem (CID 134406582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).