C11H16F3N3 — CID 134406644
N-[(1Z,3E)-4-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]ethanimine (PubChem CID 134406644) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is N-[(1Z,3E)-4-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1Z,3E)-4-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 134406644 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[(1Z,3E)-4-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C\C=C\N1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3N3/c1-2-15-5-3-4-7-17-8-6-16-10(9-17)11(12,13)14/h2-5,7,10,16H,6,8-9H2,1H3/b5-3-,7-4+,15-2+ |
| InChIKey | GVUZXAUNLANFFR-BSJOVPAGSA-N |
| XLogP | 1.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|