C11H21N3 — CID 134406702
(2Z,4E)-6-(1,4-diazepan-1-yl)hexa-2,4-dien-2-amine (PubChem CID 134406702) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (2Z,4E)-6-(1,4-diazepan-1-yl)hexa-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-6-(1,4-diazepan-1-yl)hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134406702 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (2Z,4E)-6-(1,4-diazepan-1-yl)hexa-2,4-dien-2-amine |
| SMILES | C/C(N)=C/C=C/CN1CCCNCC1 |
| InChI | InChI=1S/C11H21N3/c1-11(12)5-2-3-8-14-9-4-6-13-7-10-14/h2-3,5,13H,4,6-10,12H2,1H3/b3-2+,11-5- |
| InChIKey | DCNDJPHHQXGIDB-OIUYUKGDSA-N |
| XLogP | 0.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|