C15H31N3 — CID 134406773
(2E,4Z)-1-N-[2-[ethyl(methyl)amino]ethyl]-2,6,6-trimethylhepta-2,4-diene-1,5-diamine (PubChem CID 134406773) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is (2E,4Z)-1-N-[2-[ethyl(methyl)amino]ethyl]-2,6,6-trimethylhepta-2,4-diene-1,5-diamine.
| Compound Name | (2E,4Z)-1-N-[2-[ethyl(methyl)amino]ethyl]-2,6,6-trimethylhepta-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 134406773 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | (2E,4Z)-1-N-[2-[ethyl(methyl)amino]ethyl]-2,6,6-trimethylhepta-2,4-diene-1,5-diamine |
| SMILES | CCN(C)CCNC/C(C)=C/C=C(\N)C(C)(C)C |
| InChI | InChI=1S/C15H31N3/c1-7-18(6)11-10-17-12-13(2)8-9-14(16)15(3,4)5/h8-9,17H,7,10-12,16H2,1-6H3/b13-8+,14-9- |
| InChIKey | XZPDYOKYAHHGMA-MGDWIPCISA-N |
| XLogP | 2.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|