C11H14IN3O2 — CID 134406781
2-hydroxy-1-[4-(6-iodo-3-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 134406781) has the molecular formula C11H14IN3O2 and a molecular weight of 347.16 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(6-iodo-3-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[4-(6-iodo-3-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134406781 |
| Molecular Formula | C11H14IN3O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-hydroxy-1-[4-(6-iodo-3-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CO)N1CCN(c2ccc(I)nc2)CC1 |
| InChI | InChI=1S/C11H14IN3O2/c12-10-2-1-9(7-13-10)14-3-5-15(6-4-14)11(17)8-16/h1-2,7,16H,3-6,8H2 |
| InChIKey | YWTFLJBWDNKDJX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|