C11H19N3O — CID 134406798
(2E,4Z)-N-[2-(dimethylamino)ethyl]-5-(methylideneamino)hexa-2,4-dienamide (PubChem CID 134406798) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E,4Z)-N-[2-(dimethylamino)ethyl]-5-(methylideneamino)hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-N-[2-(dimethylamino)ethyl]-5-(methylideneamino)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 134406798 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (2E,4Z)-N-[2-(dimethylamino)ethyl]-5-(methylideneamino)hexa-2,4-dienamide |
| SMILES | C=N/C(C)=C\C=C\C(=O)NCCN(C)C |
| InChI | InChI=1S/C11H19N3O/c1-10(12-2)6-5-7-11(15)13-8-9-14(3)4/h5-7H,2,8-9H2,1,3-4H3,(H,13,15)/b7-5+,10-6- |
| InChIKey | OXSJZYHGYMCAKO-ZUVZAJTGSA-N |
| XLogP | 0.82 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|