C17H23F2N — CID 134406911
3,5-difluoro-N-[(2E,4E,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 134406911) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is 3,5-difluoro-N-[(2E,4E,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 3,5-difluoro-N-[(2E,4E,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134406911 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3,5-difluoro-N-[(2E,4E,6Z)-5-propan-2-ylocta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | C/C=C\C(=C\C(=C/C)NC1C=C(F)C=C(F)C1)C(C)C |
| InChI | InChI=1S/C17H23F2N/c1-5-7-13(12(3)4)8-16(6-2)20-17-10-14(18)9-15(19)11-17/h5-10,12,17,20H,11H2,1-4H3/b7-5-,13-8-,16-6- |
| InChIKey | WJSGPLPNINDYAG-LCOLUASCSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|