C22H21F7O5 — CID 134406948
(3S,4S,5R,6R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]oxane-3,4-diol (PubChem CID 134406948) has the molecular formula C22H21F7O5 and a molecular weight of 498.39 g/mol. Its IUPAC name is (3S,4S,5R,6R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]oxane-3,4-diol.
| Compound Name | (3S,4S,5R,6R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 134406948 |
| Molecular Formula | C22H21F7O5 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (3S,4S,5R,6R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]oxane-3,4-diol |
| SMILES | C[C@@H](O[C@H]1OC[C@H](O)[C@H](O)C1OCc1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F7O5/c1-11(13-6-14(21(24,25)26)8-15(7-13)22(27,28)29)34-20-19(18(31)17(30)10-33-20)32-9-12-2-4-16(23)5-3-12/h2-8,11,17-20,30-31H,9-10H2,1H3/t11-,17+,18+,19?,20-/m1/s1 |
| InChIKey | ZTUNFLBIIFQDKG-QGWXLVOKSA-N |
| XLogP | 4.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |