C11H14N2O2 — CID 134407001
3-(1,2-dihydro-1,8-naphthyridin-2-yl)propane-1,1-diol (PubChem CID 134407001) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-(1,2-dihydro-1,8-naphthyridin-2-yl)propane-1,1-diol.
| Compound Name | 3-(1,2-dihydro-1,8-naphthyridin-2-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 134407001 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-(1,2-dihydro-1,8-naphthyridin-2-yl)propane-1,1-diol |
| SMILES | OC(O)CCC1C=Cc2cccnc2N1 |
| InChI | InChI=1S/C11H14N2O2/c14-10(15)6-5-9-4-3-8-2-1-7-12-11(8)13-9/h1-4,7,9-10,14-15H,5-6H2,(H,12,13) |
| InChIKey | YJVWVYPOMDWUGG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|