C20H23ClN2O2 — CID 134407241
methyl 2-[7-amino-4-(4-chlorophenyl)-1,2,6-trimethyl-2,3-dihydroindol-5-yl]acetate (PubChem CID 134407241) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is methyl 2-[7-amino-4-(4-chlorophenyl)-1,2,6-trimethyl-2,3-dihydroindol-5-yl]acetate.
| Compound Name | methyl 2-[7-amino-4-(4-chlorophenyl)-1,2,6-trimethyl-2,3-dihydroindol-5-yl]acetate |
|---|---|
| PubChem CID | 134407241 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 2-[7-amino-4-(4-chlorophenyl)-1,2,6-trimethyl-2,3-dihydroindol-5-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c(N)c2c(c1-c1ccc(Cl)cc1)CC(C)N2C |
| InChI | InChI=1S/C20H23ClN2O2/c1-11-9-16-18(13-5-7-14(21)8-6-13)15(10-17(24)25-4)12(2)19(22)20(16)23(11)3/h5-8,11H,9-10,22H2,1-4H3 |
| InChIKey | XNPGENBNGAGVLK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|