C25H32N6O2 — CID 134407248
methyl 2-[2,5,7-trimethyl-9-[5-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate (PubChem CID 134407248) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is methyl 2-[2,5,7-trimethyl-9-[5-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate.
| Compound Name | methyl 2-[2,5,7-trimethyl-9-[5-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate |
|---|---|
| PubChem CID | 134407248 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | methyl 2-[2,5,7-trimethyl-9-[5-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2c3c(cc(C)n3CCN2c2ncc(N3CCN(C)CC3)cn2)c1C |
| InChI | InChI=1S/C25H32N6O2/c1-16-12-21-17(2)20(13-22(32)33-5)18(3)23-24(21)30(16)10-11-31(23)25-26-14-19(15-27-25)29-8-6-28(4)7-9-29/h12,14-15H,6-11,13H2,1-5H3 |
| InChIKey | IFNNUQVBNDBYRM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |