C23H28N2O2S — CID 134407268
6-ethyl-9-ethylsulfonyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 134407268) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 6-ethyl-9-ethylsulfonyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 6-ethyl-9-ethylsulfonyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 134407268 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 6-ethyl-9-ethylsulfonyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | CCc1c(C)c2c3c(cc(C)n3CCN2S(=O)(=O)CC)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-6-19-17(5)22-23-20(21(19)18-10-8-15(3)9-11-18)14-16(4)24(23)12-13-25(22)28(26,27)7-2/h8-11,14H,6-7,12-13H2,1-5H3 |
| InChIKey | YIBZXANPSACMEP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |